C9H17N3O2 — CID 550706
5-tert-butyl-1,3,5-triazinane-1,3-dicarbaldehyde (PubChem CID 550706) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 5-tert-butyl-1,3,5-triazinane-1,3-dicarbaldehyde.
| Compound Name | 5-tert-butyl-1,3,5-triazinane-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 550706 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 5-tert-butyl-1,3,5-triazinane-1,3-dicarbaldehyde |
| SMILES | CC(C)(C)N1CN(C=O)CN(C=O)C1 |
| InChI | InChI=1S/C9H17N3O2/c1-9(2,3)12-5-10(7-13)4-11(6-12)8-14/h7-8H,4-6H2,1-3H3 |
| InChIKey | QFMSPNVQZLQZMX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|