C12H25N3O — CID 14638327
3,5-ditert-butyl-1,3,5-triazinane-1-carbaldehyde (PubChem CID 14638327) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 3,5-ditert-butyl-1,3,5-triazinane-1-carbaldehyde.
| Compound Name | 3,5-ditert-butyl-1,3,5-triazinane-1-carbaldehyde |
|---|---|
| PubChem CID | 14638327 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 3,5-ditert-butyl-1,3,5-triazinane-1-carbaldehyde |
| SMILES | CC(C)(C)N1CN(C=O)CN(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H25N3O/c1-11(2,3)14-7-13(10-16)8-15(9-14)12(4,5)6/h10H,7-9H2,1-6H3 |
| InChIKey | FANOMXFYLIBIID-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|