C8H17N3O — CID 90783932
1,3,4,4,5-pentamethyl-1,3,5-triazinan-2-one (PubChem CID 90783932) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 1,3,4,4,5-pentamethyl-1,3,5-triazinan-2-one.
| Compound Name | 1,3,4,4,5-pentamethyl-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 90783932 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 1,3,4,4,5-pentamethyl-1,3,5-triazinan-2-one |
| SMILES | CN1CN(C)C(C)(C)N(C)C1=O |
| InChI | InChI=1S/C8H17N3O/c1-8(2)10(4)6-9(3)7(12)11(8)5/h6H2,1-5H3 |
| InChIKey | NQYHQXUBTJFFLX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |