C15H31N3O — CID 24974965
1,3,5-tritert-butyl-1,3,5-triazinan-2-one (PubChem CID 24974965) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is 1,3,5-tritert-butyl-1,3,5-triazinan-2-one.
| Compound Name | 1,3,5-tritert-butyl-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 24974965 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | 1,3,5-tritert-butyl-1,3,5-triazinan-2-one |
| SMILES | CC(C)(C)N1CN(C(C)(C)C)C(=O)N(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H31N3O/c1-13(2,3)16-10-17(14(4,5)6)12(19)18(11-16)15(7,8)9/h10-11H2,1-9H3 |
| InChIKey | HMRFCHNIUNEVGH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |