C11H23N3O — CID 15121486
1,5-ditert-butyl-1,3,5-triazinan-2-one (PubChem CID 15121486) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 1,5-ditert-butyl-1,3,5-triazinan-2-one.
| Compound Name | 1,5-ditert-butyl-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 15121486 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 1,5-ditert-butyl-1,3,5-triazinan-2-one |
| SMILES | CC(C)(C)N1CNC(=O)N(C(C)(C)C)C1 |
| InChI | InChI=1S/C11H23N3O/c1-10(2,3)13-7-12-9(15)14(8-13)11(4,5)6/h7-8H2,1-6H3,(H,12,15) |
| InChIKey | CCJFPHRQWLMCEG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |