C11H23N3O4 — CID 21292573
1,5-ditert-butyl-6-hydroperoxy-4-hydroxy-1,3,5-triazinan-2-one (PubChem CID 21292573) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1,5-ditert-butyl-6-hydroperoxy-4-hydroxy-1,3,5-triazinan-2-one.
| Compound Name | 1,5-ditert-butyl-6-hydroperoxy-4-hydroxy-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 21292573 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1,5-ditert-butyl-6-hydroperoxy-4-hydroxy-1,3,5-triazinan-2-one |
| SMILES | CC(C)(C)N1C(=O)NC(O)N(C(C)(C)C)C1OO |
| InChI | InChI=1S/C11H23N3O4/c1-10(2,3)13-7(15)12-8(16)14(9(13)18-17)11(4,5)6/h7,9,15,17H,1-6H3,(H,12,16) |
| InChIKey | FNUZIVGMKQGDBP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|