About methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate
methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate (PubChem CID 139373575) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate |
| PubChem CID | 139373575 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cccn([C@H]2CCC[C@H](O)C2)c1=O |
| InChI | InChI=1S/C13H17NO4/c1-18-13(17)11-6-3-7-14(12(11)16)9-4-2-5-10(15)8-9/h3,6-7,9-10,15H,2,4-5,8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | RBBPZSKVIHHPNK-UWVGGRQHSA-N |
| XLogP | 1.11 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate?
The IUPAC name of methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate (CID 139373575) is methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate.
What is the SMILES notation for methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate?
The canonical SMILES for methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate is COC(=O)c1cccn([C@H]2CCC[C@H](O)C2)c1=O.
What is the InChIKey of methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate?
The InChIKey is RBBPZSKVIHHPNK-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H17NO4/c1-18-13(17)11-6-3-7-14(12(11)16)9-4-2-5-10(15)8-9/h3,6-7,9-10,15H,2,4-5,8H2,1H3/t9-,10-/m0/s1.
What are the key properties of methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate?
methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate has a molecular weight of 251.28 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(1S,3S)-3-hydroxycyclohexyl]-2-oxopyridine-3-carboxylate is sourced from PubChem (CID 139373575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).