C11H13NO4 — CID 146327520
methyl 2-oxo-1-[(3S)-oxolan-3-yl]pyridine-3-carboxylate (PubChem CID 146327520) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl 2-oxo-1-[(3S)-oxolan-3-yl]pyridine-3-carboxylate.
| Compound Name | methyl 2-oxo-1-[(3S)-oxolan-3-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 146327520 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | methyl 2-oxo-1-[(3S)-oxolan-3-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccn([C@H]2CCOC2)c1=O |
| InChI | InChI=1S/C11H13NO4/c1-15-11(14)9-3-2-5-12(10(9)13)8-4-6-16-7-8/h2-3,5,8H,4,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | FRCVQJMBEWORRQ-QMMMGPOBSA-N |
| XLogP | 0.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |