C11H13NO3 — CID 139390457
methyl 1-cyclobutyl-2-oxopyridine-3-carboxylate (PubChem CID 139390457) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is methyl 1-cyclobutyl-2-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-cyclobutyl-2-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 139390457 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | methyl 1-cyclobutyl-2-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cccn(C2CCC2)c1=O |
| InChI | InChI=1S/C11H13NO3/c1-15-11(14)9-6-3-7-12(10(9)13)8-4-2-5-8/h3,6-8H,2,4-5H2,1H3 |
| InChIKey | QQJOXZGRUAZHLD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |