C28H31FN4O6 — CID 139375049
2-[[2-cyclohexyl-2-[[5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-formylamino]acetyl]amino]acetic acid (PubChem CID 139375049) has the molecular formula C28H31FN4O6 and a molecular weight of 538.58 g/mol. Its IUPAC name is 2-[[2-cyclohexyl-2-[[5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-formylamino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-cyclohexyl-2-[[5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-formylamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 139375049 |
| Molecular Formula | C28H31FN4O6 |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-[[2-cyclohexyl-2-[[5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-formylamino]acetyl]amino]acetic acid |
| SMILES | COc1cccc(OC)c1-c1cc(N(C=O)C(C(=O)NCC(=O)O)C2CCCCC2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H31FN4O6/c1-38-22-9-6-10-23(39-2)26(22)21-15-24(31-33(21)20-13-11-19(29)12-14-20)32(17-34)27(18-7-4-3-5-8-18)28(37)30-16-25(35)36/h6,9-15,17-18,27H,3-5,7-8,16H2,1-2H3,(H,30,37)(H,35,36) |
| InChIKey | AJRHZBKWEPZRGD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|