C28H42N4O4 — CID 118561203
N-[(1S)-2-(butylamino)-1-cyclohexyl-2-oxoethyl]-3-(2,6-dimethoxyphenyl)-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide (PubChem CID 118561203) has the molecular formula C28H42N4O4 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[(1S)-2-(butylamino)-1-cyclohexyl-2-oxoethyl]-3-(2,6-dimethoxyphenyl)-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(1S)-2-(butylamino)-1-cyclohexyl-2-oxoethyl]-3-(2,6-dimethoxyphenyl)-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118561203 |
| Molecular Formula | C28H42N4O4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | N-[(1S)-2-(butylamino)-1-cyclohexyl-2-oxoethyl]-3-(2,6-dimethoxyphenyl)-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCCCNC(=O)[C@H](C1CCCCC1)N(CC(C)C)C(=O)c1cc(-c2c(OC)cccc2OC)n[nH]1 |
| InChI | InChI=1S/C28H42N4O4/c1-6-7-16-29-27(33)26(20-12-9-8-10-13-20)32(18-19(2)3)28(34)22-17-21(30-31-22)25-23(35-4)14-11-15-24(25)36-5/h11,14-15,17,19-20,26H,6-10,12-13,16,18H2,1-5H3,(H,29,33)(H,30,31)/t26-/m0/s1 |
| InChIKey | CKKCATIIJBAUCQ-SANMLTNESA-N |
| XLogP | 5.06 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|