C25H38N2O2 — CID 145207801
N-[2-(butylamino)-1-cyclohexyl-2-oxoethyl]-2-methyl-N-prop-2-ynylbenzamide;ethane (PubChem CID 145207801) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N-[2-(butylamino)-1-cyclohexyl-2-oxoethyl]-2-methyl-N-prop-2-ynylbenzamide;ethane.
| Compound Name | N-[2-(butylamino)-1-cyclohexyl-2-oxoethyl]-2-methyl-N-prop-2-ynylbenzamide;ethane |
|---|---|
| PubChem CID | 145207801 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N-[2-(butylamino)-1-cyclohexyl-2-oxoethyl]-2-methyl-N-prop-2-ynylbenzamide;ethane |
| SMILES | C#CCN(C(=O)c1ccccc1C)C(C(=O)NCCCC)C1CCCCC1.CC |
| InChI | InChI=1S/C23H32N2O2.C2H6/c1-4-6-16-24-22(26)21(19-13-8-7-9-14-19)25(17-5-2)23(27)20-15-11-10-12-18(20)3;1-2/h2,10-12,15,19,21H,4,6-9,13-14,16-17H2,1,3H3,(H,24,26);1-2H3 |
| InChIKey | KBGSGRIRZZRKRB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|