C25H34N2O3 — CID 155088191
N-[1-cyclohexyl-2-(cyclohexylmethylamino)-2-oxoethyl]-2-hydroxy-N-prop-2-ynylbenzamide (PubChem CID 155088191) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-(cyclohexylmethylamino)-2-oxoethyl]-2-hydroxy-N-prop-2-ynylbenzamide.
| Compound Name | N-[1-cyclohexyl-2-(cyclohexylmethylamino)-2-oxoethyl]-2-hydroxy-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 155088191 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-[1-cyclohexyl-2-(cyclohexylmethylamino)-2-oxoethyl]-2-hydroxy-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(C(=O)c1ccccc1O)C(C(=O)NCC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H34N2O3/c1-2-17-27(25(30)21-15-9-10-16-22(21)28)23(20-13-7-4-8-14-20)24(29)26-18-19-11-5-3-6-12-19/h1,9-10,15-16,19-20,23,28H,3-8,11-14,17-18H2,(H,26,29) |
| InChIKey | VCKXGNCBAYGSBU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|