C27H40N2O2 — CID 145207901
N-cyclohexyl-N-[2-(cyclohexylamino)-1-cyclopentyl-2-oxoethyl]-2-methylbenzamide (PubChem CID 145207901) has the molecular formula C27H40N2O2 and a molecular weight of 424.63 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-(cyclohexylamino)-1-cyclopentyl-2-oxoethyl]-2-methylbenzamide.
| Compound Name | N-cyclohexyl-N-[2-(cyclohexylamino)-1-cyclopentyl-2-oxoethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 145207901 |
| Molecular Formula | C27H40N2O2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | N-cyclohexyl-N-[2-(cyclohexylamino)-1-cyclopentyl-2-oxoethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C1CCCCC1)C(C(=O)NC1CCCCC1)C1CCCC1 |
| InChI | InChI=1S/C27H40N2O2/c1-20-12-8-11-19-24(20)27(31)29(23-17-6-3-7-18-23)25(21-13-9-10-14-21)26(30)28-22-15-4-2-5-16-22/h8,11-12,19,21-23,25H,2-7,9-10,13-18H2,1H3,(H,28,30) |
| InChIKey | NZZJYABWDRPIPS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |