C24H36IN3O2 — CID 155771405
N-[5-amino-1-(cyclohexylamino)-1-oxopentan-2-yl]-N-cyclohexyl-2-iodobenzamide (PubChem CID 155771405) has the molecular formula C24H36IN3O2 and a molecular weight of 525.48 g/mol. Its IUPAC name is N-[5-amino-1-(cyclohexylamino)-1-oxopentan-2-yl]-N-cyclohexyl-2-iodobenzamide.
| Compound Name | N-[5-amino-1-(cyclohexylamino)-1-oxopentan-2-yl]-N-cyclohexyl-2-iodobenzamide |
|---|---|
| PubChem CID | 155771405 |
| Molecular Formula | C24H36IN3O2 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | N-[5-amino-1-(cyclohexylamino)-1-oxopentan-2-yl]-N-cyclohexyl-2-iodobenzamide |
| SMILES | NCCCC(C(=O)NC1CCCCC1)N(C(=O)c1ccccc1I)C1CCCCC1 |
| InChI | InChI=1S/C24H36IN3O2/c25-21-15-8-7-14-20(21)24(30)28(19-12-5-2-6-13-19)22(16-9-17-26)23(29)27-18-10-3-1-4-11-18/h7-8,14-15,18-19,22H,1-6,9-13,16-17,26H2,(H,27,29) |
| InChIKey | IWLQKMQCEGEINI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|