C29H27F2IN2O3 — CID 54739999
N-benzyl-N-[(E)-3-(cyclohexylamino)-1-(2,4-difluorophenyl)-1-hydroxy-3-oxoprop-1-en-2-yl]-2-iodobenzamide (PubChem CID 54739999) has the molecular formula C29H27F2IN2O3 and a molecular weight of 616.45 g/mol. Its IUPAC name is N-benzyl-N-[(E)-3-(cyclohexylamino)-1-(2,4-difluorophenyl)-1-hydroxy-3-oxoprop-1-en-2-yl]-2-iodobenzamide.
| Compound Name | N-benzyl-N-[(E)-3-(cyclohexylamino)-1-(2,4-difluorophenyl)-1-hydroxy-3-oxoprop-1-en-2-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 54739999 |
| Molecular Formula | C29H27F2IN2O3 |
| Molecular Weight | 616.45 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | N-benzyl-N-[(E)-3-(cyclohexylamino)-1-(2,4-difluorophenyl)-1-hydroxy-3-oxoprop-1-en-2-yl]-2-iodobenzamide |
| SMILES | O=C(NC1CCCCC1)/C(=C(\O)c1ccc(F)cc1F)N(Cc1ccccc1)C(=O)c1ccccc1I |
| InChI | InChI=1S/C29H27F2IN2O3/c30-20-15-16-22(24(31)17-20)27(35)26(28(36)33-21-11-5-2-6-12-21)34(18-19-9-3-1-4-10-19)29(37)23-13-7-8-14-25(23)32/h1,3-4,7-10,13-17,21,35H,2,5-6,11-12,18H2,(H,33,36)/b27-26+ |
| InChIKey | QOQNHVIGKTYNMU-CYYJNZCTSA-N |
| XLogP | 6.59 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|