C31H36N2O2 — CID 140923009
N-[2-(butylamino)-1-cyclohexyl-2-oxoethyl]-N,2-diphenylbenzamide (PubChem CID 140923009) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is N-[2-(butylamino)-1-cyclohexyl-2-oxoethyl]-N,2-diphenylbenzamide.
| Compound Name | N-[2-(butylamino)-1-cyclohexyl-2-oxoethyl]-N,2-diphenylbenzamide |
|---|---|
| PubChem CID | 140923009 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | N-[2-(butylamino)-1-cyclohexyl-2-oxoethyl]-N,2-diphenylbenzamide |
| SMILES | CCCCNC(=O)C(C1CCCCC1)N(C(=O)c1ccccc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36N2O2/c1-2-3-23-32-30(34)29(25-17-9-5-10-18-25)33(26-19-11-6-12-20-26)31(35)28-22-14-13-21-27(28)24-15-7-4-8-16-24/h4,6-8,11-16,19-22,25,29H,2-3,5,9-10,17-18,23H2,1H3,(H,32,34) |
| InChIKey | DWIPQLPYMWAPRV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|