C24H33N5O2 — CID 53041392
N-benzyl-2-[butyl-(pyrazine-2-carbonylamino)amino]-2-cyclohexylacetamide (PubChem CID 53041392) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-benzyl-2-[butyl-(pyrazine-2-carbonylamino)amino]-2-cyclohexylacetamide.
| Compound Name | N-benzyl-2-[butyl-(pyrazine-2-carbonylamino)amino]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 53041392 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N-benzyl-2-[butyl-(pyrazine-2-carbonylamino)amino]-2-cyclohexylacetamide |
| SMILES | CCCCN(NC(=O)c1cnccn1)C(C(=O)NCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H33N5O2/c1-2-3-16-29(28-23(30)21-18-25-14-15-26-21)22(20-12-8-5-9-13-20)24(31)27-17-19-10-6-4-7-11-19/h4,6-7,10-11,14-15,18,20,22H,2-3,5,8-9,12-13,16-17H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | GFMJUZDBZIFMQD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|