C17H29N5O3 — CID 95058633
(2S)-2-[butyl-(pyrazine-2-carbonylamino)amino]-N-(2-methoxyethyl)pentanamide (PubChem CID 95058633) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S)-2-[butyl-(pyrazine-2-carbonylamino)amino]-N-(2-methoxyethyl)pentanamide.
| Compound Name | (2S)-2-[butyl-(pyrazine-2-carbonylamino)amino]-N-(2-methoxyethyl)pentanamide |
|---|---|
| PubChem CID | 95058633 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (2S)-2-[butyl-(pyrazine-2-carbonylamino)amino]-N-(2-methoxyethyl)pentanamide |
| SMILES | CCCCN(NC(=O)c1cnccn1)[C@@H](CCC)C(=O)NCCOC |
| InChI | InChI=1S/C17H29N5O3/c1-4-6-11-22(21-16(23)14-13-18-8-9-19-14)15(7-5-2)17(24)20-10-12-25-3/h8-9,13,15H,4-7,10-12H2,1-3H3,(H,20,24)(H,21,23)/t15-/m0/s1 |
| InChIKey | DNIMDNYPXQEYKE-HNNXBMFYSA-N |
| XLogP | 1.15 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|