C25H35N5O2 — CID 95058623
(2S)-N-benzyl-2-cyclohexyl-2-[3-methylbutyl-(pyrazine-2-carbonylamino)amino]acetamide (PubChem CID 95058623) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is (2S)-N-benzyl-2-cyclohexyl-2-[3-methylbutyl-(pyrazine-2-carbonylamino)amino]acetamide.
| Compound Name | (2S)-N-benzyl-2-cyclohexyl-2-[3-methylbutyl-(pyrazine-2-carbonylamino)amino]acetamide |
|---|---|
| PubChem CID | 95058623 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | (2S)-N-benzyl-2-cyclohexyl-2-[3-methylbutyl-(pyrazine-2-carbonylamino)amino]acetamide |
| SMILES | CC(C)CCN(NC(=O)c1cnccn1)[C@H](C(=O)NCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C25H35N5O2/c1-19(2)13-16-30(29-24(31)22-18-26-14-15-27-22)23(21-11-7-4-8-12-21)25(32)28-17-20-9-5-3-6-10-20/h3,5-6,9-10,14-15,18-19,21,23H,4,7-8,11-13,16-17H2,1-2H3,(H,28,32)(H,29,31)/t23-/m0/s1 |
| InChIKey | FXIAVJLESWFXED-QHCPKHFHSA-N |
| XLogP | 3.73 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|