C27H42N4O4 — CID 118561175
N-[(3S)-1-(butylamino)-5-methyl-1-oxohexan-3-yl]-3-(2,6-dimethoxyphenyl)-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide (PubChem CID 118561175) has the molecular formula C27H42N4O4 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-[(3S)-1-(butylamino)-5-methyl-1-oxohexan-3-yl]-3-(2,6-dimethoxyphenyl)-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3S)-1-(butylamino)-5-methyl-1-oxohexan-3-yl]-3-(2,6-dimethoxyphenyl)-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118561175 |
| Molecular Formula | C27H42N4O4 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | N-[(3S)-1-(butylamino)-5-methyl-1-oxohexan-3-yl]-3-(2,6-dimethoxyphenyl)-N-(2-methylpropyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCCCNC(=O)C[C@H](CC(C)C)N(CC(C)C)C(=O)c1cc(-c2c(OC)cccc2OC)n[nH]1 |
| InChI | InChI=1S/C27H42N4O4/c1-8-9-13-28-25(32)15-20(14-18(2)3)31(17-19(4)5)27(33)22-16-21(29-30-22)26-23(34-6)11-10-12-24(26)35-7/h10-12,16,18-20H,8-9,13-15,17H2,1-7H3,(H,28,32)(H,29,30)/t20-/m0/s1 |
| InChIKey | BSQHYOCNCRFGMA-FQEVSTJZSA-N |
| XLogP | 4.91 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|