C18H20BrFN6O2 — CID 139375143
1-(3-bromopropyl)-3-[5-[(5-fluoro-2-hydroxyphenyl)methyl-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]urea (PubChem CID 139375143) has the molecular formula C18H20BrFN6O2 and a molecular weight of 451.30 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3-[5-[(5-fluoro-2-hydroxyphenyl)methyl-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]urea.
| Compound Name | 1-(3-bromopropyl)-3-[5-[(5-fluoro-2-hydroxyphenyl)methyl-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]urea |
|---|---|
| PubChem CID | 139375143 |
| Molecular Formula | C18H20BrFN6O2 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 1-(3-bromopropyl)-3-[5-[(5-fluoro-2-hydroxyphenyl)methyl-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]urea |
| SMILES | CN(Cc1cc(F)ccc1O)c1ccn2ncc(NC(=O)NCCCBr)c2n1 |
| InChI | InChI=1S/C18H20BrFN6O2/c1-25(11-12-9-13(20)3-4-15(12)27)16-5-8-26-17(24-16)14(10-22-26)23-18(28)21-7-2-6-19/h3-5,8-10,27H,2,6-7,11H2,1H3,(H2,21,23,28) |
| InChIKey | GFINCKOYUCUGOX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|