C11H18F2 — CID 139376879
(Z,5E)-2-fluoro-5-(1-fluoroethylidene)non-3-ene (PubChem CID 139376879) has the molecular formula C11H18F2 and a molecular weight of 188.26 g/mol. Its IUPAC name is (Z,5E)-2-fluoro-5-(1-fluoroethylidene)non-3-ene.
| Compound Name | (Z,5E)-2-fluoro-5-(1-fluoroethylidene)non-3-ene |
|---|---|
| PubChem CID | 139376879 |
| Molecular Formula | C11H18F2 |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (Z,5E)-2-fluoro-5-(1-fluoroethylidene)non-3-ene |
| SMILES | CCCCC(/C=C\C(C)F)=C(/C)F |
| InChI | InChI=1S/C11H18F2/c1-4-5-6-11(10(3)13)8-7-9(2)12/h7-9H,4-6H2,1-3H3/b8-7-,11-10+ |
| InChIKey | UHEBUFYXCRCIIN-QEFCTBRHSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|