C27H27N5O2 — CID 139377951
N-[4-[[[2-(2,4-dimethylindol-1-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 139377951) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[4-[[[2-(2,4-dimethylindol-1-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[[[2-(2,4-dimethylindol-1-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139377951 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[4-[[[2-(2,4-dimethylindol-1-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CNc2nc(-n3c(C)cc4c(C)cccc43)nc3c2COCC3)cc1 |
| InChI | InChI=1S/C27H27N5O2/c1-4-25(33)29-20-10-8-19(9-11-20)15-28-26-22-16-34-13-12-23(22)30-27(31-26)32-18(3)14-21-17(2)6-5-7-24(21)32/h4-11,14H,1,12-13,15-16H2,2-3H3,(H,29,33)(H,28,30,31) |
| InChIKey | OOBBWNJCJJWPAN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|