C11H21N3O2S — CID 139379412
(2S,3R)-3-hydroxy-2-[3-(sulfanylmethyl)-2,5-diazaspiro[3.4]octan-2-yl]butanamide (PubChem CID 139379412) has the molecular formula C11H21N3O2S and a molecular weight of 259.38 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[3-(sulfanylmethyl)-2,5-diazaspiro[3.4]octan-2-yl]butanamide.
| Compound Name | (2S,3R)-3-hydroxy-2-[3-(sulfanylmethyl)-2,5-diazaspiro[3.4]octan-2-yl]butanamide |
|---|---|
| PubChem CID | 139379412 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[3-(sulfanylmethyl)-2,5-diazaspiro[3.4]octan-2-yl]butanamide |
| SMILES | C[C@@H](O)[C@@H](C(N)=O)N1CC2(CCCN2)C1CS |
| InChI | InChI=1S/C11H21N3O2S/c1-7(15)9(10(12)16)14-6-11(8(14)5-17)3-2-4-13-11/h7-9,13,15,17H,2-6H2,1H3,(H2,12,16)/t7-,8?,9+,11?/m1/s1 |
| InChIKey | UGCOVEGUIBUVEN-AZPRYWSXSA-N |
| XLogP | -1.04 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|