C31H41IN4O12 — CID 139381090
2-[[5-[[2-[[2-[2,2-bis(hydroxymethyl)-3-iodopropoxy]acetyl]amino]-3-naphthalen-2-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]butanedioic acid (PubChem CID 139381090) has the molecular formula C31H41IN4O12 and a molecular weight of 788.59 g/mol. Its IUPAC name is 2-[[5-[[2-[[2-[2,2-bis(hydroxymethyl)-3-iodopropoxy]acetyl]amino]-3-naphthalen-2-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]butanedioic acid.
| Compound Name | 2-[[5-[[2-[[2-[2,2-bis(hydroxymethyl)-3-iodopropoxy]acetyl]amino]-3-naphthalen-2-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 139381090 |
| Molecular Formula | C31H41IN4O12 |
| Molecular Weight | 788.59 g/mol |
| Exact Mass | 788.18 |
| IUPAC Name | 2-[[5-[[2-[[2-[2,2-bis(hydroxymethyl)-3-iodopropoxy]acetyl]amino]-3-naphthalen-2-ylpropanoyl]amino]-1-carboxypentyl]carbamoylamino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)NC(CCCCNC(=O)C(Cc1ccc2ccccc2c1)NC(=O)COCC(CO)(CO)CI)C(=O)O)C(=O)O |
| InChI | InChI=1S/C31H41IN4O12/c32-15-31(16-37,17-38)18-48-14-25(39)34-23(12-19-8-9-20-5-1-2-6-21(20)11-19)27(42)33-10-4-3-7-22(28(43)44)35-30(47)36-24(29(45)46)13-26(40)41/h1-2,5-6,8-9,11,22-24,37-38H,3-4,7,10,12-18H2,(H,33,42)(H,34,39)(H,40,41)(H,43,44)(H,45,46)(H2,35,36,47) |
| InChIKey | CYFVKTULMRBZEU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 260.92 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.59 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|