methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate

C14H26O2 — CID 139381646

IUPACmethyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate
SMILESCC=CC(CC(C)(C)C)(C(=O)OC)C(C)C
InChIInChI=1S/C14H26O2/c1-8-9-14(11(2)3,12(15)16-7)10-13(4,5)6/h8-9,11H,10H2,1-7H3
InChIKeyXVABXUGRUCIQCB-UHFFFAOYSA-N
MW226.36 g/mol
LogP3.81
Rot. Bonds4

About methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate

methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate (PubChem CID 139381646) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate.

Molecular Properties

Compound Namemethyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate
PubChem CID139381646
Molecular FormulaC14H26O2
Molecular Weight226.36 g/mol
Exact Mass226.19
IUPAC Namemethyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate
SMILESCC=CC(CC(C)(C)C)(C(=O)OC)C(C)C
InChIInChI=1S/C14H26O2/c1-8-9-14(11(2)3,12(15)16-7)10-13(4,5)6/h8-9,11H,10H2,1-7H3
InChIKeyXVABXUGRUCIQCB-UHFFFAOYSA-N
XLogP3.81
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.36
LogP ≤ 53.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate?
The IUPAC name of methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate (CID 139381646) is methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate.
What is the SMILES notation for methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate?
The canonical SMILES for methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate is CC=CC(CC(C)(C)C)(C(=O)OC)C(C)C.
What is the InChIKey of methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate?
The InChIKey is XVABXUGRUCIQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-8-9-14(11(2)3,12(15)16-7)10-13(4,5)6/h8-9,11H,10H2,1-7H3.
What are the key properties of methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate?
methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate has a molecular weight of 226.36 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate is sourced from PubChem (CID 139381646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).