C14H26O2 — CID 139381646
methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate (PubChem CID 139381646) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate.
| Compound Name | methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate |
|---|---|
| PubChem CID | 139381646 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | methyl 2-(2,2-dimethylpropyl)-2-propan-2-ylpent-3-enoate |
| SMILES | CC=CC(CC(C)(C)C)(C(=O)OC)C(C)C |
| InChI | InChI=1S/C14H26O2/c1-8-9-14(11(2)3,12(15)16-7)10-13(4,5)6/h8-9,11H,10H2,1-7H3 |
| InChIKey | XVABXUGRUCIQCB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|