C10H18O3S2 — CID 139384512
(4S)-4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione (PubChem CID 139384512) has the molecular formula C10H18O3S2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (4S)-4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione.
| Compound Name | (4S)-4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione |
|---|---|
| PubChem CID | 139384512 |
| Molecular Formula | C10H18O3S2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | (4S)-4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione |
| SMILES | CCOC(CC[C@H]1COC(=S)S1)OCC |
| InChI | InChI=1S/C10H18O3S2/c1-3-11-9(12-4-2)6-5-8-7-13-10(14)15-8/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
| InChIKey | UPDHDDZLIXJMOL-QMMMGPOBSA-N |
| XLogP | 2.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|