C11H16O2S5 — CID 11121380
4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-dithiole-2-thione (PubChem CID 11121380) has the molecular formula C11H16O2S5 and a molecular weight of 340.58 g/mol. Its IUPAC name is 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-dithiole-2-thione.
| Compound Name | 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-dithiole-2-thione |
|---|---|
| PubChem CID | 11121380 |
| Molecular Formula | C11H16O2S5 |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 4-methylsulfanyl-5-[2-(oxan-2-yloxy)ethylsulfanyl]-1,3-dithiole-2-thione |
| SMILES | CSc1sc(=S)sc1SCCOC1CCCCO1 |
| InChI | InChI=1S/C11H16O2S5/c1-15-9-10(18-11(14)17-9)16-7-6-13-8-4-2-3-5-12-8/h8H,2-7H2,1H3 |
| InChIKey | NCIUZYPLWXGJML-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|