C27H22Cl3N3O4S — CID 139388802
N-[(E)-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 139388802) has the molecular formula C27H22Cl3N3O4S and a molecular weight of 590.92 g/mol. Its IUPAC name is N-[(E)-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 139388802 |
| Molecular Formula | C27H22Cl3N3O4S |
| Molecular Weight | 590.92 g/mol |
| Exact Mass | 589.04 |
| IUPAC Name | N-[(E)-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/c2ccc(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)cc2Cl)cc1 |
| InChI | InChI=1S/C27H22Cl3N3O4S/c1-16-5-11-20(12-6-16)38(34,35)33-31-14-18-9-10-19(13-24(18)30)36-15-21-26(32-37-27(21)17-7-8-17)25-22(28)3-2-4-23(25)29/h2-6,9-14,17,33H,7-8,15H2,1H3/b31-14+ |
| InChIKey | FOQOAOYSGIPDFK-XAZZYMPDSA-N |
| XLogP | 7.38 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.92 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|