C17H17F2NO — CID 139388979
3-(dibenzylamino)-2,2-difluoropropanal (PubChem CID 139388979) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-(dibenzylamino)-2,2-difluoropropanal.
| Compound Name | 3-(dibenzylamino)-2,2-difluoropropanal |
|---|---|
| PubChem CID | 139388979 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-(dibenzylamino)-2,2-difluoropropanal |
| SMILES | O=CC(F)(F)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H17F2NO/c18-17(19,14-21)13-20(11-15-7-3-1-4-8-15)12-16-9-5-2-6-10-16/h1-10,14H,11-13H2 |
| InChIKey | AYJOVEQFZCBNMV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|