About 2-(dibenzylamino)ethyl formate
2-(dibenzylamino)ethyl formate (PubChem CID 24829039) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(dibenzylamino)ethyl formate.
Molecular Properties
| Compound Name | 2-(dibenzylamino)ethyl formate |
| PubChem CID | 24829039 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(dibenzylamino)ethyl formate |
| SMILES | O=COCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c19-15-20-12-11-18(13-16-7-3-1-4-8-16)14-17-9-5-2-6-10-17/h1-10,15H,11-14H2 |
| InChIKey | IHXNIOULDZVDEF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dibenzylamino)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibenzylamino)ethyl formate?
The IUPAC name of 2-(dibenzylamino)ethyl formate (CID 24829039) is 2-(dibenzylamino)ethyl formate.
What is the SMILES notation for 2-(dibenzylamino)ethyl formate?
The canonical SMILES for 2-(dibenzylamino)ethyl formate is O=COCCN(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 2-(dibenzylamino)ethyl formate?
The InChIKey is IHXNIOULDZVDEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c19-15-20-12-11-18(13-16-7-3-1-4-8-16)14-17-9-5-2-6-10-17/h1-10,15H,11-14H2.
What are the key properties of 2-(dibenzylamino)ethyl formate?
2-(dibenzylamino)ethyl formate has a molecular weight of 269.34 g/mol, XLogP of 2.86, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibenzylamino)ethyl formate is sourced from PubChem (CID 24829039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).