C15H18BrN3O5S — CID 139392213
2-[5-[(4-bromo-2-methylphenyl)carbamoyl]-1-methylpyrazol-4-yl]oxyethyl methanesulfonate (PubChem CID 139392213) has the molecular formula C15H18BrN3O5S and a molecular weight of 432.30 g/mol. Its IUPAC name is 2-[5-[(4-bromo-2-methylphenyl)carbamoyl]-1-methylpyrazol-4-yl]oxyethyl methanesulfonate.
| Compound Name | 2-[5-[(4-bromo-2-methylphenyl)carbamoyl]-1-methylpyrazol-4-yl]oxyethyl methanesulfonate |
|---|---|
| PubChem CID | 139392213 |
| Molecular Formula | C15H18BrN3O5S |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 2-[5-[(4-bromo-2-methylphenyl)carbamoyl]-1-methylpyrazol-4-yl]oxyethyl methanesulfonate |
| SMILES | Cc1cc(Br)ccc1NC(=O)c1c(OCCOS(C)(=O)=O)cnn1C |
| InChI | InChI=1S/C15H18BrN3O5S/c1-10-8-11(16)4-5-12(10)18-15(20)14-13(9-17-19(14)2)23-6-7-24-25(3,21)22/h4-5,8-9H,6-7H2,1-3H3,(H,18,20) |
| InChIKey | JADYHTRZVOYGFC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|