C14H16BrIN3O3P — CID 139408354
N-(4-bromo-2-methylphenyl)-4-(2-hydroxypropoxy)-1-iodophosphanylpyrazole-5-carboxamide (PubChem CID 139408354) has the molecular formula C14H16BrIN3O3P and a molecular weight of 512.08 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-4-(2-hydroxypropoxy)-1-iodophosphanylpyrazole-5-carboxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-4-(2-hydroxypropoxy)-1-iodophosphanylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 139408354 |
| Molecular Formula | C14H16BrIN3O3P |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 510.92 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-4-(2-hydroxypropoxy)-1-iodophosphanylpyrazole-5-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)c1c(OCC(C)O)cnn1PI |
| InChI | InChI=1S/C14H16BrIN3O3P/c1-8-5-10(15)3-4-11(8)18-14(21)13-12(22-7-9(2)20)6-17-19(13)23-16/h3-6,9,20,23H,7H2,1-2H3,(H,18,21) |
| InChIKey | YERHSHSFCXGXDQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|