C19H28N4 — CID 139397678
3-N-[3-(2-methylhydrazinyl)prop-1-en-2-yl]-1-N-(naphthalen-1-ylmethyl)butane-1,3-diamine (PubChem CID 139397678) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is 3-N-[3-(2-methylhydrazinyl)prop-1-en-2-yl]-1-N-(naphthalen-1-ylmethyl)butane-1,3-diamine.
| Compound Name | 3-N-[3-(2-methylhydrazinyl)prop-1-en-2-yl]-1-N-(naphthalen-1-ylmethyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 139397678 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 3-N-[3-(2-methylhydrazinyl)prop-1-en-2-yl]-1-N-(naphthalen-1-ylmethyl)butane-1,3-diamine |
| SMILES | C=C(CNNC)NC(C)CCNCc1cccc2ccccc12 |
| InChI | InChI=1S/C19H28N4/c1-15(23-16(2)13-22-20-3)11-12-21-14-18-9-6-8-17-7-4-5-10-19(17)18/h4-10,15,20-23H,2,11-14H2,1,3H3 |
| InChIKey | CGGULEFANJFLMZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|