About (4-iodophenyl) hypoiodite
(4-iodophenyl) hypoiodite (PubChem CID 139399233) has the molecular formula C6H4I2O
and a molecular weight of 345.91 g/mol. Its IUPAC name is (4-iodophenyl) hypoiodite.
Molecular Properties
| Compound Name | (4-iodophenyl) hypoiodite |
| PubChem CID | 139399233 |
| Molecular Formula | C6H4I2O |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.84 |
| IUPAC Name | (4-iodophenyl) hypoiodite |
| SMILES | IOc1ccc(I)cc1 |
| InChI | InChI=1S/C6H4I2O/c7-5-1-3-6(9-8)4-2-5/h1-4H |
| InChIKey | OOYMLKVTAOBLBX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-iodophenyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodophenyl) hypoiodite?
The IUPAC name of (4-iodophenyl) hypoiodite (CID 139399233) is (4-iodophenyl) hypoiodite.
What is the SMILES notation for (4-iodophenyl) hypoiodite?
The canonical SMILES for (4-iodophenyl) hypoiodite is IOc1ccc(I)cc1.
What is the InChIKey of (4-iodophenyl) hypoiodite?
The InChIKey is OOYMLKVTAOBLBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4I2O/c7-5-1-3-6(9-8)4-2-5/h1-4H.
What are the key properties of (4-iodophenyl) hypoiodite?
(4-iodophenyl) hypoiodite has a molecular weight of 345.91 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodophenyl) hypoiodite is sourced from PubChem (CID 139399233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).