C26H29N3O5S — CID 139402392
(6E)-6-(1-hydroxy-2-oxobut-3-enylidene)-1-methyl-4-(2-methylsulfonylethyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-1,2,4-triazinan-5-one (PubChem CID 139402392) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is (6E)-6-(1-hydroxy-2-oxobut-3-enylidene)-1-methyl-4-(2-methylsulfonylethyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-1,2,4-triazinan-5-one.
| Compound Name | (6E)-6-(1-hydroxy-2-oxobut-3-enylidene)-1-methyl-4-(2-methylsulfonylethyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-1,2,4-triazinan-5-one |
|---|---|
| PubChem CID | 139402392 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (6E)-6-(1-hydroxy-2-oxobut-3-enylidene)-1-methyl-4-(2-methylsulfonylethyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-1,2,4-triazinan-5-one |
| SMILES | C=CC(=O)/C(O)=C1/C(=O)N(CCS(C)(=O)=O)CN(C2c3ccccc3CCc3ccccc32)N1C |
| InChI | InChI=1S/C26H29N3O5S/c1-4-22(30)25(31)24-26(32)28(15-16-35(3,33)34)17-29(27(24)2)23-20-11-7-5-9-18(20)13-14-19-10-6-8-12-21(19)23/h4-12,23,31H,1,13-17H2,2-3H3/b25-24+ |
| InChIKey | MJDBKENUNTYZNS-OCOZRVBESA-N |
| XLogP | 2.39 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|