C27H26N4O3S — CID 139402505
(6E)-6-(1-hydroxy-2-oxobut-3-enylidene)-1-methyl-4-(1,3-thiazol-2-ylmethyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-1,2,4-triazinan-5-one (PubChem CID 139402505) has the molecular formula C27H26N4O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is (6E)-6-(1-hydroxy-2-oxobut-3-enylidene)-1-methyl-4-(1,3-thiazol-2-ylmethyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-1,2,4-triazinan-5-one.
| Compound Name | (6E)-6-(1-hydroxy-2-oxobut-3-enylidene)-1-methyl-4-(1,3-thiazol-2-ylmethyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-1,2,4-triazinan-5-one |
|---|---|
| PubChem CID | 139402505 |
| Molecular Formula | C27H26N4O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (6E)-6-(1-hydroxy-2-oxobut-3-enylidene)-1-methyl-4-(1,3-thiazol-2-ylmethyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-1,2,4-triazinan-5-one |
| SMILES | C=CC(=O)/C(O)=C1/C(=O)N(Cc2nccs2)CN(C2c3ccccc3CCc3ccccc32)N1C |
| InChI | InChI=1S/C27H26N4O3S/c1-3-22(32)26(33)25-27(34)30(16-23-28-14-15-35-23)17-31(29(25)2)24-20-10-6-4-8-18(20)12-13-19-9-5-7-11-21(19)24/h3-11,14-15,24,33H,1,12-13,16-17H2,2H3/b26-25+ |
| InChIKey | QROPJCHZDHZJBI-OCEACIFDSA-N |
| XLogP | 4.00 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|