C20H29ClO3 — CID 139403535
(1R,3R,4S,8S,14S,19R)-19-chloro-17-hydroxy-8-methyl-20-oxapentacyclo[11.6.1.03,11.04,8.014,19]icosan-7-one (PubChem CID 139403535) has the molecular formula C20H29ClO3 and a molecular weight of 352.90 g/mol. Its IUPAC name is (1R,3R,4S,8S,14S,19R)-19-chloro-17-hydroxy-8-methyl-20-oxapentacyclo[11.6.1.03,11.04,8.014,19]icosan-7-one.
| Compound Name | (1R,3R,4S,8S,14S,19R)-19-chloro-17-hydroxy-8-methyl-20-oxapentacyclo[11.6.1.03,11.04,8.014,19]icosan-7-one |
|---|---|
| PubChem CID | 139403535 |
| Molecular Formula | C20H29ClO3 |
| Molecular Weight | 352.90 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (1R,3R,4S,8S,14S,19R)-19-chloro-17-hydroxy-8-methyl-20-oxapentacyclo[11.6.1.03,11.04,8.014,19]icosan-7-one |
| SMILES | C[C@]12CCC3CC4O[C@H](C[C@H]3[C@@H]1CCC2=O)[C@@]1(Cl)CC(O)CC[C@@H]41 |
| InChI | InChI=1S/C20H29ClO3/c1-19-7-6-11-8-16-15-3-2-12(22)10-20(15,21)18(24-16)9-13(11)14(19)4-5-17(19)23/h11-16,18,22H,2-10H2,1H3/t11?,12?,13-,14+,15+,16?,18-,19+,20-/m1/s1 |
| InChIKey | BQAHSPZDJMWQCV-SEWQFFFGSA-N |
| XLogP | 3.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|