About (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide
(3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide (PubChem CID 139406105) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide |
| PubChem CID | 139406105 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide |
| SMILES | C=N/C(=N\CC)N1CCOC[C@H]1C |
| InChI | InChI=1S/C9H17N3O/c1-4-11-9(10-3)12-5-6-13-7-8(12)2/h8H,3-7H2,1-2H3/b11-9+/t8-/m1/s1 |
| InChIKey | AUSKFMMVDKMOFP-ITCPUHJZSA-N |
| XLogP | 0.78 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide?
The IUPAC name of (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide (CID 139406105) is (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide.
What is the SMILES notation for (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide?
The canonical SMILES for (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide is C=N/C(=N\CC)N1CCOC[C@H]1C.
What is the InChIKey of (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide?
The InChIKey is AUSKFMMVDKMOFP-ITCPUHJZSA-N. The full InChI is InChI=1S/C9H17N3O/c1-4-11-9(10-3)12-5-6-13-7-8(12)2/h8H,3-7H2,1-2H3/b11-9+/t8-/m1/s1.
What are the key properties of (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide?
(3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide has a molecular weight of 183.25 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N'-ethyl-3-methyl-N-methylidenemorpholine-4-carboximidamide is sourced from PubChem (CID 139406105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).