About 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine
1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine (PubChem CID 57132672) has the molecular formula C9H17N5O
and a molecular weight of 211.27 g/mol. Its IUPAC name is 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine.
Molecular Properties
| Compound Name | 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine |
| PubChem CID | 57132672 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine |
| SMILES | CC1COCCN1CN1C=NC(N)=NC1 |
| InChI | InChI=1S/C9H17N5O/c1-8-4-15-3-2-14(8)7-13-5-11-9(10)12-6-13/h5,8H,2-4,6-7H2,1H3,(H2,10,12) |
| InChIKey | XNQKWZHICZUUDO-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 66.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine?
The IUPAC name of 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine (CID 57132672) is 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine.
What is the SMILES notation for 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine?
The canonical SMILES for 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine is CC1COCCN1CN1C=NC(N)=NC1.
What is the InChIKey of 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine?
The InChIKey is XNQKWZHICZUUDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5O/c1-8-4-15-3-2-14(8)7-13-5-11-9(10)12-6-13/h5,8H,2-4,6-7H2,1H3,(H2,10,12).
What are the key properties of 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine?
1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine has a molecular weight of 211.27 g/mol, XLogP of -0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methylmorpholin-4-yl)methyl]-2H-1,3,5-triazin-4-amine is sourced from PubChem (CID 57132672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).