C37H38F3NO2 — CID 139406770
4-[4-[1-(5-methylhept-6-enyl)piperidin-4-yl]phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid (PubChem CID 139406770) has the molecular formula C37H38F3NO2 and a molecular weight of 585.71 g/mol. Its IUPAC name is 4-[4-[1-(5-methylhept-6-enyl)piperidin-4-yl]phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid.
| Compound Name | 4-[4-[1-(5-methylhept-6-enyl)piperidin-4-yl]phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 139406770 |
| Molecular Formula | C37H38F3NO2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 4-[4-[1-(5-methylhept-6-enyl)piperidin-4-yl]phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid |
| SMILES | C=CC(C)CCCCN1CCC(c2ccc(-c3cc(C(=O)O)cc4cc(-c5ccc(C(F)(F)F)cc5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C37H38F3NO2/c1-3-25(2)6-4-5-19-41-20-17-28(18-21-41)26-7-9-29(10-8-26)35-24-32(36(42)43)23-31-22-30(13-16-34(31)35)27-11-14-33(15-12-27)37(38,39)40/h3,7-16,22-25,28H,1,4-6,17-21H2,2H3,(H,42,43) |
| InChIKey | YBSOIBMOMQQTLH-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|