C37H38F3NO2 — CID 164585656
4-[4-[1-(2,2-dimethylbut-3-ynyl)piperidin-4-yl]phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid;ethane (PubChem CID 164585656) has the molecular formula C37H38F3NO2 and a molecular weight of 585.71 g/mol. Its IUPAC name is 4-[4-[1-(2,2-dimethylbut-3-ynyl)piperidin-4-yl]phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid;ethane.
| Compound Name | 4-[4-[1-(2,2-dimethylbut-3-ynyl)piperidin-4-yl]phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 164585656 |
| Molecular Formula | C37H38F3NO2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 4-[4-[1-(2,2-dimethylbut-3-ynyl)piperidin-4-yl]phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid;ethane |
| SMILES | C#CC(C)(C)CN1CCC(c2ccc(-c3cc(C(=O)O)cc4cc(-c5ccc(C(F)(F)F)cc5)ccc34)cc2)CC1.CC |
| InChI | InChI=1S/C35H32F3NO2.C2H6/c1-4-34(2,3)22-39-17-15-25(16-18-39)23-5-7-26(8-6-23)32-21-29(33(40)41)20-28-19-27(11-14-31(28)32)24-9-12-30(13-10-24)35(36,37)38;1-2/h1,5-14,19-21,25H,15-18,22H2,2-3H3,(H,40,41);1-2H3 |
| InChIKey | IWXROIIBKUIROL-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|