C34H30F3NO2 — CID 139392093
ethyl 4-[4-(1-prop-2-ynylpiperidin-4-yl)phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylate (PubChem CID 139392093) has the molecular formula C34H30F3NO2 and a molecular weight of 541.61 g/mol. Its IUPAC name is ethyl 4-[4-(1-prop-2-ynylpiperidin-4-yl)phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylate.
| Compound Name | ethyl 4-[4-(1-prop-2-ynylpiperidin-4-yl)phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139392093 |
| Molecular Formula | C34H30F3NO2 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | ethyl 4-[4-(1-prop-2-ynylpiperidin-4-yl)phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylate |
| SMILES | C#CCN1CCC(c2ccc(-c3cc(C(=O)OCC)cc4cc(-c5ccc(C(F)(F)F)cc5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C34H30F3NO2/c1-3-17-38-18-15-25(16-19-38)23-5-7-26(8-6-23)32-22-29(33(39)40-4-2)21-28-20-27(11-14-31(28)32)24-9-12-30(13-10-24)34(35,36)37/h1,5-14,20-22,25H,4,15-19H2,2H3 |
| InChIKey | KUXPHMLCVVSELB-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|