C12H25NO3S — CID 139410617
3-[(1,2-dimethylcyclohexyl)amino]-2-methylpropane-1-sulfonic acid (PubChem CID 139410617) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is 3-[(1,2-dimethylcyclohexyl)amino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 3-[(1,2-dimethylcyclohexyl)amino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 139410617 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 3-[(1,2-dimethylcyclohexyl)amino]-2-methylpropane-1-sulfonic acid |
| SMILES | CC(CNC1(C)CCCCC1C)CS(=O)(=O)O |
| InChI | InChI=1S/C12H25NO3S/c1-10(9-17(14,15)16)8-13-12(3)7-5-4-6-11(12)2/h10-11,13H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | OCNDTVLUGODXLO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|