C13H27NO3S — CID 139410636
2-methyl-3-[(1,2,2-trimethylcyclohexyl)amino]propane-1-sulfonic acid (PubChem CID 139410636) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is 2-methyl-3-[(1,2,2-trimethylcyclohexyl)amino]propane-1-sulfonic acid.
| Compound Name | 2-methyl-3-[(1,2,2-trimethylcyclohexyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139410636 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-methyl-3-[(1,2,2-trimethylcyclohexyl)amino]propane-1-sulfonic acid |
| SMILES | CC(CNC1(C)CCCCC1(C)C)CS(=O)(=O)O |
| InChI | InChI=1S/C13H27NO3S/c1-11(10-18(15,16)17)9-14-13(4)8-6-5-7-12(13,2)3/h11,14H,5-10H2,1-4H3,(H,15,16,17) |
| InChIKey | XTIPATFHOYXHHX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|