About lithium;sodium;2-tert-butyl-2-pentylpropanedioate
lithium;sodium;2-tert-butyl-2-pentylpropanedioate (PubChem CID 139411371) has the molecular formula C12H20LiNaO4
and a molecular weight of 258.22 g/mol. Its IUPAC name is lithium;sodium;2-tert-butyl-2-pentylpropanedioate.
Molecular Properties
| Compound Name | lithium;sodium;2-tert-butyl-2-pentylpropanedioate |
| PubChem CID | 139411371 |
| Molecular Formula | C12H20LiNaO4 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | lithium;sodium;2-tert-butyl-2-pentylpropanedioate |
| SMILES | CCCCCC(C(=O)[O-])(C(=O)[O-])C(C)(C)C.[Li+].[Na+] |
| InChI | InChI=1S/C12H22O4.Li.Na/c1-5-6-7-8-12(9(13)14,10(15)16)11(2,3)4;;/h5-8H2,1-4H3,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | IAYAHSSMEBVVDN-UHFFFAOYSA-L |
| XLogP | -5.89 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze lithium;sodium;2-tert-butyl-2-pentylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;sodium;2-tert-butyl-2-pentylpropanedioate?
The IUPAC name of lithium;sodium;2-tert-butyl-2-pentylpropanedioate (CID 139411371) is lithium;sodium;2-tert-butyl-2-pentylpropanedioate.
What is the SMILES notation for lithium;sodium;2-tert-butyl-2-pentylpropanedioate?
The canonical SMILES for lithium;sodium;2-tert-butyl-2-pentylpropanedioate is CCCCCC(C(=O)[O-])(C(=O)[O-])C(C)(C)C.[Li+].[Na+].
What is the InChIKey of lithium;sodium;2-tert-butyl-2-pentylpropanedioate?
The InChIKey is IAYAHSSMEBVVDN-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H22O4.Li.Na/c1-5-6-7-8-12(9(13)14,10(15)16)11(2,3)4;;/h5-8H2,1-4H3,(H,13,14)(H,15,16);;/q;2*+1/p-2.
What are the key properties of lithium;sodium;2-tert-butyl-2-pentylpropanedioate?
lithium;sodium;2-tert-butyl-2-pentylpropanedioate has a molecular weight of 258.22 g/mol, XLogP of -5.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;sodium;2-tert-butyl-2-pentylpropanedioate is sourced from PubChem (CID 139411371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).