C13H22KLiO4 — CID 139411544
lithium;potassium;2-heptyl-2-propan-2-ylpropanedioate (PubChem CID 139411544) has the molecular formula C13H22KLiO4 and a molecular weight of 288.35 g/mol. Its IUPAC name is lithium;potassium;2-heptyl-2-propan-2-ylpropanedioate.
| Compound Name | lithium;potassium;2-heptyl-2-propan-2-ylpropanedioate |
|---|---|
| PubChem CID | 139411544 |
| Molecular Formula | C13H22KLiO4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | lithium;potassium;2-heptyl-2-propan-2-ylpropanedioate |
| SMILES | CCCCCCCC(C(=O)[O-])(C(=O)[O-])C(C)C.[K+].[Li+] |
| InChI | InChI=1S/C13H24O4.K.Li/c1-4-5-6-7-8-9-13(10(2)3,11(14)15)12(16)17;;/h10H,4-9H2,1-3H3,(H,14,15)(H,16,17);;/q;2*+1/p-2 |
| InChIKey | ZKMTYXUHAYUAEF-UHFFFAOYSA-L |
| XLogP | -5.50 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|