C19H34LiNaO4 — CID 139412058
lithium;sodium;2-octan-3-yl-2-octylpropanedioate (PubChem CID 139412058) has the molecular formula C19H34LiNaO4 and a molecular weight of 356.41 g/mol. Its IUPAC name is lithium;sodium;2-octan-3-yl-2-octylpropanedioate.
| Compound Name | lithium;sodium;2-octan-3-yl-2-octylpropanedioate |
|---|---|
| PubChem CID | 139412058 |
| Molecular Formula | C19H34LiNaO4 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | lithium;sodium;2-octan-3-yl-2-octylpropanedioate |
| SMILES | CCCCCCCCC(C(=O)[O-])(C(=O)[O-])C(CC)CCCCC.[Li+].[Na+] |
| InChI | InChI=1S/C19H36O4.Li.Na/c1-4-7-9-10-11-13-15-19(17(20)21,18(22)23)16(6-3)14-12-8-5-2;;/h16H,4-15H2,1-3H3,(H,20,21)(H,22,23);;/q;2*+1/p-2 |
| InChIKey | VWQMWLZPJAGWRN-UHFFFAOYSA-L |
| XLogP | -3.16 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|