C15H14F4N4O2 — CID 139416282
2-fluoro-6-[3-[2-[2-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 139416282) has the molecular formula C15H14F4N4O2 and a molecular weight of 358.30 g/mol. Its IUPAC name is 2-fluoro-6-[3-[2-[2-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-fluoro-6-[3-[2-[2-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139416282 |
| Molecular Formula | C15H14F4N4O2 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-fluoro-6-[3-[2-[2-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(-n2ccc(OCCC3CC3C(F)(F)F)n2)nc1F |
| InChI | InChI=1S/C15H14F4N4O2/c16-13-9(14(20)24)1-2-11(21-13)23-5-3-12(22-23)25-6-4-8-7-10(8)15(17,18)19/h1-3,5,8,10H,4,6-7H2,(H2,20,24) |
| InChIKey | POXPHAXQNHXKOH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|